C8H19N3O2S — CID 131124354
4-[(dimethylamino)methyl]-1-methylsulfonylpyrrolidin-3-amine (PubChem CID 131124354) has the molecular formula C8H19N3O2S and a molecular weight of 221.33 g/mol. Its IUPAC name is 4-[(dimethylamino)methyl]-1-methylsulfonylpyrrolidin-3-amine.
| Compound Name | 4-[(dimethylamino)methyl]-1-methylsulfonylpyrrolidin-3-amine |
|---|---|
| PubChem CID | 131124354 |
| Molecular Formula | C8H19N3O2S |
| Molecular Weight | 221.33 g/mol |
| Exact Mass | 221.12 |
| IUPAC Name | 4-[(dimethylamino)methyl]-1-methylsulfonylpyrrolidin-3-amine |
| SMILES | CN(C)CC1CN(S(C)(=O)=O)CC1N |
| InChI | InChI=1S/C8H19N3O2S/c1-10(2)4-7-5-11(6-8(7)9)14(3,12)13/h7-8H,4-6,9H2,1-3H3 |
| InChIKey | UBOHKDZCBLELNK-UHFFFAOYSA-N |
| XLogP | -1.23 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.33 |
| LogP ≤ 5 | -1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |