C18H22N6OS — CID 70741977
1-[2-[[(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)amino]methyl]-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-5-yl]ethanone (PubChem CID 70741977) has the molecular formula C18H22N6OS and a molecular weight of 370.48 g/mol. Its IUPAC name is 1-[2-[[(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)amino]methyl]-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-5-yl]ethanone.
| Compound Name | 1-[2-[[(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)amino]methyl]-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-5-yl]ethanone |
|---|---|
| PubChem CID | 70741977 |
| Molecular Formula | C18H22N6OS |
| Molecular Weight | 370.48 g/mol |
| Exact Mass | 370.16 |
| IUPAC Name | 1-[2-[[(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)amino]methyl]-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-5-yl]ethanone |
| SMILES | CC(=O)N1CCCn2nc(CNc3ncnc4sc(C)c(C)c34)cc2C1 |
| InChI | InChI=1S/C18H22N6OS/c1-11-12(2)26-18-16(11)17(20-10-21-18)19-8-14-7-15-9-23(13(3)25)5-4-6-24(15)22-14/h7,10H,4-6,8-9H2,1-3H3,(H,19,20,21) |
| InChIKey | VEKZOWIDUMAMMS-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 75.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.48 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |