C15H18N8O — CID 70740937
1-[2-[(7H-purin-6-ylamino)methyl]-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-5-yl]ethanone (PubChem CID 70740937) has the molecular formula C15H18N8O and a molecular weight of 326.36 g/mol. Its IUPAC name is 1-[2-[(7H-purin-6-ylamino)methyl]-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-5-yl]ethanone.
| Compound Name | 1-[2-[(7H-purin-6-ylamino)methyl]-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-5-yl]ethanone |
|---|---|
| PubChem CID | 70740937 |
| Molecular Formula | C15H18N8O |
| Molecular Weight | 326.36 g/mol |
| Exact Mass | 326.16 |
| IUPAC Name | 1-[2-[(7H-purin-6-ylamino)methyl]-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-5-yl]ethanone |
| SMILES | CC(=O)N1CCCn2nc(CNc3ncnc4nc[nH]c34)cc2C1 |
| InChI | InChI=1S/C15H18N8O/c1-10(24)22-3-2-4-23-12(7-22)5-11(21-23)6-16-14-13-15(18-8-17-13)20-9-19-14/h5,8-9H,2-4,6-7H2,1H3,(H2,16,17,18,19,20) |
| InChIKey | PKMOVXXZXZUGHK-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 104.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.36 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |