C18H24FN7O — CID 70747840
N-[[5-[5-fluoro-4-(methylamino)pyrimidin-2-yl]-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-2-yl]methyl]cyclobutanecarboxamide (PubChem CID 70747840) has the molecular formula C18H24FN7O and a molecular weight of 373.44 g/mol. Its IUPAC name is N-[[5-[5-fluoro-4-(methylamino)pyrimidin-2-yl]-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-2-yl]methyl]cyclobutanecarboxamide.
| Compound Name | N-[[5-[5-fluoro-4-(methylamino)pyrimidin-2-yl]-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-2-yl]methyl]cyclobutanecarboxamide |
|---|---|
| PubChem CID | 70747840 |
| Molecular Formula | C18H24FN7O |
| Molecular Weight | 373.44 g/mol |
| Exact Mass | 373.20 |
| IUPAC Name | N-[[5-[5-fluoro-4-(methylamino)pyrimidin-2-yl]-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-2-yl]methyl]cyclobutanecarboxamide |
| SMILES | CNc1nc(N2CCCn3nc(CNC(=O)C4CCC4)cc3C2)ncc1F |
| InChI | InChI=1S/C18H24FN7O/c1-20-16-15(19)10-22-18(23-16)25-6-3-7-26-14(11-25)8-13(24-26)9-21-17(27)12-4-2-5-12/h8,10,12H,2-7,9,11H2,1H3,(H,21,27)(H,20,22,23) |
| InChIKey | LZDDPZSYZSMLQP-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 87.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.44 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |