C19H30NO4+ — CID 7074959
(3R,3aS,4R,9E,11aS)-4-hydroxy-6,10-dimethyl-3-(morpholin-4-ium-4-ylmethyl)-3a,4,7,8,11,11a-hexahydro-3H-cyclodeca[b]furan-2-one (PubChem CID 7074959) has the molecular formula C19H30NO4+ and a molecular weight of 336.45 g/mol. Its IUPAC name is (3R,3aS,4R,9E,11aS)-4-hydroxy-6,10-dimethyl-3-(morpholin-4-ium-4-ylmethyl)-3a,4,7,8,11,11a-hexahydro-3H-cyclodeca[b]furan-2-one.
| Compound Name | (3R,3aS,4R,9E,11aS)-4-hydroxy-6,10-dimethyl-3-(morpholin-4-ium-4-ylmethyl)-3a,4,7,8,11,11a-hexahydro-3H-cyclodeca[b]furan-2-one |
|---|---|
| PubChem CID | 7074959 |
| Molecular Formula | C19H30NO4+ |
| Molecular Weight | 336.45 g/mol |
| Exact Mass | 336.22 |
| IUPAC Name | (3R,3aS,4R,9E,11aS)-4-hydroxy-6,10-dimethyl-3-(morpholin-4-ium-4-ylmethyl)-3a,4,7,8,11,11a-hexahydro-3H-cyclodeca[b]furan-2-one |
| SMILES | CC1=C[C@@H](O)[C@H]2[C@H](C/C(C)=C/CC1)OC(=O)[C@H]2C[NH+]1CCOCC1 |
| InChI | InChI=1S/C19H29NO4/c1-13-4-3-5-14(2)11-17-18(16(21)10-13)15(19(22)24-17)12-20-6-8-23-9-7-20/h5,10,15-18,21H,3-4,6-9,11-12H2,1-2H3/p+1/b13-10?,14-5+/t15-,16+,17-,18-/m0/s1 |
| InChIKey | KUNCFEZCZDSALJ-SSXGWJKYSA-O |
| XLogP | 0.50 |
| TPSA | 60.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.45 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|