C27H39N2O3+ — CID 3950863
3-[[4-(2,3-dimethylphenyl)piperazin-1-ium-1-yl]methyl]-4-hydroxy-4a,5-dimethyl-3,3a,4,5,6,7,9,9a-octahydrobenzo[f][1]benzofuran-2-one (PubChem CID 3950863) has the molecular formula C27H39N2O3+ and a molecular weight of 439.62 g/mol. Its IUPAC name is 3-[[4-(2,3-dimethylphenyl)piperazin-1-ium-1-yl]methyl]-4-hydroxy-4a,5-dimethyl-3,3a,4,5,6,7,9,9a-octahydrobenzo[f][1]benzofuran-2-one.
| Compound Name | 3-[[4-(2,3-dimethylphenyl)piperazin-1-ium-1-yl]methyl]-4-hydroxy-4a,5-dimethyl-3,3a,4,5,6,7,9,9a-octahydrobenzo[f][1]benzofuran-2-one |
|---|---|
| PubChem CID | 3950863 |
| Molecular Formula | C27H39N2O3+ |
| Molecular Weight | 439.62 g/mol |
| Exact Mass | 439.30 |
| IUPAC Name | 3-[[4-(2,3-dimethylphenyl)piperazin-1-ium-1-yl]methyl]-4-hydroxy-4a,5-dimethyl-3,3a,4,5,6,7,9,9a-octahydrobenzo[f][1]benzofuran-2-one |
| SMILES | Cc1cccc(N2CC[NH+](CC3C(=O)OC4CC5=CCCC(C)C5(C)C(O)C43)CC2)c1C |
| InChI | InChI=1S/C27H38N2O3/c1-17-7-5-10-22(19(17)3)29-13-11-28(12-14-29)16-21-24-23(32-26(21)31)15-20-9-6-8-18(2)27(20,4)25(24)30/h5,7,9-10,18,21,23-25,30H,6,8,11-16H2,1-4H3/p+1 |
| InChIKey | IYVNGAUMUARQSV-UHFFFAOYSA-O |
| XLogP | 2.29 |
| TPSA | 54.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.62 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|