C25H34FN2O3+ — CID 11870840
(3S,3aS,4R,4aR,5S,9aR)-3-[[4-(2-fluorophenyl)piperazin-1-ium-1-yl]methyl]-4-hydroxy-4a,5-dimethyl-3,3a,4,5,6,7,9,9a-octahydrobenzo[f][1]benzofuran-2-one (PubChem CID 11870840) has the molecular formula C25H34FN2O3+ and a molecular weight of 429.56 g/mol. Its IUPAC name is (3S,3aS,4R,4aR,5S,9aR)-3-[[4-(2-fluorophenyl)piperazin-1-ium-1-yl]methyl]-4-hydroxy-4a,5-dimethyl-3,3a,4,5,6,7,9,9a-octahydrobenzo[f][1]benzofuran-2-one.
| Compound Name | (3S,3aS,4R,4aR,5S,9aR)-3-[[4-(2-fluorophenyl)piperazin-1-ium-1-yl]methyl]-4-hydroxy-4a,5-dimethyl-3,3a,4,5,6,7,9,9a-octahydrobenzo[f][1]benzofuran-2-one |
|---|---|
| PubChem CID | 11870840 |
| Molecular Formula | C25H34FN2O3+ |
| Molecular Weight | 429.56 g/mol |
| Exact Mass | 429.25 |
| IUPAC Name | (3S,3aS,4R,4aR,5S,9aR)-3-[[4-(2-fluorophenyl)piperazin-1-ium-1-yl]methyl]-4-hydroxy-4a,5-dimethyl-3,3a,4,5,6,7,9,9a-octahydrobenzo[f][1]benzofuran-2-one |
| SMILES | C[C@H]1CCC=C2C[C@H]3OC(=O)[C@H](C[NH+]4CCN(c5ccccc5F)CC4)[C@H]3[C@@H](O)[C@@]21C |
| InChI | InChI=1S/C25H33FN2O3/c1-16-6-5-7-17-14-21-22(23(29)25(16,17)2)18(24(30)31-21)15-27-10-12-28(13-11-27)20-9-4-3-8-19(20)26/h3-4,7-9,16,18,21-23,29H,5-6,10-15H2,1-2H3/p+1/t16-,18+,21+,22+,23+,25+/m0/s1 |
| InChIKey | DLPGSFRECXFFPX-QRPYMDLRSA-O |
| XLogP | 1.82 |
| TPSA | 54.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.56 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|