C19H22N4O4 — CID 70751844
2-[2-[4-(3-methoxybenzoyl)piperazin-1-yl]-2-oxoethyl]-6-methylpyridazin-3-one (PubChem CID 70751844) has the molecular formula C19H22N4O4 and a molecular weight of 370.41 g/mol. Its IUPAC name is 2-[2-[4-(3-methoxybenzoyl)piperazin-1-yl]-2-oxoethyl]-6-methylpyridazin-3-one.
| Compound Name | 2-[2-[4-(3-methoxybenzoyl)piperazin-1-yl]-2-oxoethyl]-6-methylpyridazin-3-one |
|---|---|
| PubChem CID | 70751844 |
| Molecular Formula | C19H22N4O4 |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.16 |
| IUPAC Name | 2-[2-[4-(3-methoxybenzoyl)piperazin-1-yl]-2-oxoethyl]-6-methylpyridazin-3-one |
| SMILES | COc1cccc(C(=O)N2CCN(C(=O)Cn3nc(C)ccc3=O)CC2)c1 |
| InChI | InChI=1S/C19H22N4O4/c1-14-6-7-17(24)23(20-14)13-18(25)21-8-10-22(11-9-21)19(26)15-4-3-5-16(12-15)27-2/h3-7,12H,8-11,13H2,1-2H3 |
| InChIKey | SHXARBCNYDVQLK-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 84.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |