C20H34N4O2 — CID 70756192
cis-(1R,2S)-1-N-butyl-2-N-[(1-ethyl-3,5-dimethylpyrazol-4-yl)methyl]cyclohexane-1,2-dicarboxamide (PubChem CID 70756192) has the molecular formula C20H34N4O2 and a molecular weight of 362.52 g/mol. Its IUPAC name is cis-(1R,2S)-1-N-butyl-2-N-[(1-ethyl-3,5-dimethylpyrazol-4-yl)methyl]cyclohexane-1,2-dicarboxamide.
| Compound Name | cis-(1R,2S)-1-N-butyl-2-N-[(1-ethyl-3,5-dimethylpyrazol-4-yl)methyl]cyclohexane-1,2-dicarboxamide |
|---|---|
| PubChem CID | 70756192 |
| Molecular Formula | C20H34N4O2 |
| Molecular Weight | 362.52 g/mol |
| Exact Mass | 362.27 |
| IUPAC Name | cis-(1R,2S)-1-N-butyl-2-N-[(1-ethyl-3,5-dimethylpyrazol-4-yl)methyl]cyclohexane-1,2-dicarboxamide |
| SMILES | CCCCNC(=O)[C@@H]1CCCC[C@@H]1C(=O)NCc1c(C)nn(CC)c1C |
| InChI | InChI=1S/C20H34N4O2/c1-5-7-12-21-19(25)16-10-8-9-11-17(16)20(26)22-13-18-14(3)23-24(6-2)15(18)4/h16-17H,5-13H2,1-4H3,(H,21,25)(H,22,26)/t16-,17+/m1/s1 |
| InChIKey | SIGUXSRAHIUUHT-SJORKVTESA-N |
| XLogP | 2.86 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.52 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|