C16H15ClN2O2S — CID 70763084
1-(4-chlorophenyl)-5-methyl-4-(thiophene-2-carbonyl)piperazin-2-one (PubChem CID 70763084) has the molecular formula C16H15ClN2O2S and a molecular weight of 334.83 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-5-methyl-4-(thiophene-2-carbonyl)piperazin-2-one.
| Compound Name | 1-(4-chlorophenyl)-5-methyl-4-(thiophene-2-carbonyl)piperazin-2-one |
|---|---|
| PubChem CID | 70763084 |
| Molecular Formula | C16H15ClN2O2S |
| Molecular Weight | 334.83 g/mol |
| Exact Mass | 334.05 |
| IUPAC Name | 1-(4-chlorophenyl)-5-methyl-4-(thiophene-2-carbonyl)piperazin-2-one |
| SMILES | CC1CN(c2ccc(Cl)cc2)C(=O)CN1C(=O)c1cccs1 |
| InChI | InChI=1S/C16H15ClN2O2S/c1-11-9-19(13-6-4-12(17)5-7-13)15(20)10-18(11)16(21)14-3-2-8-22-14/h2-8,11H,9-10H2,1H3 |
| InChIKey | QYZZTSBYWATGIZ-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.83 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |