C16H17ClN4O2 — CID 70775777
1-(4-chlorophenyl)-5-methyl-4-(5-methyl-1H-pyrazole-3-carbonyl)piperazin-2-one (PubChem CID 70775777) has the molecular formula C16H17ClN4O2 and a molecular weight of 332.79 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-5-methyl-4-(5-methyl-1H-pyrazole-3-carbonyl)piperazin-2-one.
| Compound Name | 1-(4-chlorophenyl)-5-methyl-4-(5-methyl-1H-pyrazole-3-carbonyl)piperazin-2-one |
|---|---|
| PubChem CID | 70775777 |
| Molecular Formula | C16H17ClN4O2 |
| Molecular Weight | 332.79 g/mol |
| Exact Mass | 332.10 |
| IUPAC Name | 1-(4-chlorophenyl)-5-methyl-4-(5-methyl-1H-pyrazole-3-carbonyl)piperazin-2-one |
| SMILES | Cc1cc(C(=O)N2CC(=O)N(c3ccc(Cl)cc3)CC2C)n[nH]1 |
| InChI | InChI=1S/C16H17ClN4O2/c1-10-7-14(19-18-10)16(23)20-9-15(22)21(8-11(20)2)13-5-3-12(17)4-6-13/h3-7,11H,8-9H2,1-2H3,(H,18,19) |
| InChIKey | JTUDKHVRUNNFLX-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 69.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.79 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |