C18H30N4O2S — CID 70765643
2-(3-methoxypropyl)-9-(5-propyl-1,3,4-thiadiazol-2-yl)-2,9-diazaspiro[5.5]undecan-3-one (PubChem CID 70765643) has the molecular formula C18H30N4O2S and a molecular weight of 366.53 g/mol. Its IUPAC name is 2-(3-methoxypropyl)-9-(5-propyl-1,3,4-thiadiazol-2-yl)-2,9-diazaspiro[5.5]undecan-3-one.
| Compound Name | 2-(3-methoxypropyl)-9-(5-propyl-1,3,4-thiadiazol-2-yl)-2,9-diazaspiro[5.5]undecan-3-one |
|---|---|
| PubChem CID | 70765643 |
| Molecular Formula | C18H30N4O2S |
| Molecular Weight | 366.53 g/mol |
| Exact Mass | 366.21 |
| IUPAC Name | 2-(3-methoxypropyl)-9-(5-propyl-1,3,4-thiadiazol-2-yl)-2,9-diazaspiro[5.5]undecan-3-one |
| SMILES | CCCc1nnc(N2CCC3(CCC(=O)N(CCCOC)C3)CC2)s1 |
| InChI | InChI=1S/C18H30N4O2S/c1-3-5-15-19-20-17(25-15)21-11-8-18(9-12-21)7-6-16(23)22(14-18)10-4-13-24-2/h3-14H2,1-2H3 |
| InChIKey | LWVLGEQMYNLTAG-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.53 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|