C13H20N8O — CID 70769257
1-(2-aminoethyl)-N-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylmethyl)triazole-4-carboxamide (PubChem CID 70769257) has the molecular formula C13H20N8O and a molecular weight of 304.36 g/mol. Its IUPAC name is 1-(2-aminoethyl)-N-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylmethyl)triazole-4-carboxamide.
| Compound Name | 1-(2-aminoethyl)-N-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylmethyl)triazole-4-carboxamide |
|---|---|
| PubChem CID | 70769257 |
| Molecular Formula | C13H20N8O |
| Molecular Weight | 304.36 g/mol |
| Exact Mass | 304.18 |
| IUPAC Name | 1-(2-aminoethyl)-N-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylmethyl)triazole-4-carboxamide |
| SMILES | NCCn1cc(C(=O)NCc2nnc3n2CCCCC3)nn1 |
| InChI | InChI=1S/C13H20N8O/c14-5-7-20-9-10(16-19-20)13(22)15-8-12-18-17-11-4-2-1-3-6-21(11)12/h9H,1-8,14H2,(H,15,22) |
| InChIKey | YQNBAGZLKQRSKG-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 116.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.36 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |