C13H15ClN4O3 — CID 70770814
7-[3-(4-chloropyrazol-1-yl)propanoyl]-2,7-diazaspiro[4.4]nonane-1,3-dione (PubChem CID 70770814) has the molecular formula C13H15ClN4O3 and a molecular weight of 310.74 g/mol. Its IUPAC name is 7-[3-(4-chloropyrazol-1-yl)propanoyl]-2,7-diazaspiro[4.4]nonane-1,3-dione.
| Compound Name | 7-[3-(4-chloropyrazol-1-yl)propanoyl]-2,7-diazaspiro[4.4]nonane-1,3-dione |
|---|---|
| PubChem CID | 70770814 |
| Molecular Formula | C13H15ClN4O3 |
| Molecular Weight | 310.74 g/mol |
| Exact Mass | 310.08 |
| IUPAC Name | 7-[3-(4-chloropyrazol-1-yl)propanoyl]-2,7-diazaspiro[4.4]nonane-1,3-dione |
| SMILES | O=C1CC2(CCN(C(=O)CCn3cc(Cl)cn3)C2)C(=O)N1 |
| InChI | InChI=1S/C13H15ClN4O3/c14-9-6-15-18(7-9)3-1-11(20)17-4-2-13(8-17)5-10(19)16-12(13)21/h6-7H,1-5,8H2,(H,16,19,21) |
| InChIKey | YPCSAECLXYHGRI-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.74 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|