C19H28ClN5O5 — CID 171322772
8-[3-(4-chloropyrazol-1-yl)propanoyl]-3-methyl-1-(2-methylpropyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione;formic acid (PubChem CID 171322772) has the molecular formula C19H28ClN5O5 and a molecular weight of 441.92 g/mol. Its IUPAC name is 8-[3-(4-chloropyrazol-1-yl)propanoyl]-3-methyl-1-(2-methylpropyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione;formic acid.
| Compound Name | 8-[3-(4-chloropyrazol-1-yl)propanoyl]-3-methyl-1-(2-methylpropyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione;formic acid |
|---|---|
| PubChem CID | 171322772 |
| Molecular Formula | C19H28ClN5O5 |
| Molecular Weight | 441.92 g/mol |
| Exact Mass | 441.18 |
| IUPAC Name | 8-[3-(4-chloropyrazol-1-yl)propanoyl]-3-methyl-1-(2-methylpropyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione;formic acid |
| SMILES | CC(C)CN1C(=O)N(C)C(=O)C12CCN(C(=O)CCn1cc(Cl)cn1)CC2.O=CO |
| InChI | InChI=1S/C18H26ClN5O3.CH2O2/c1-13(2)11-24-17(27)21(3)16(26)18(24)5-8-22(9-6-18)15(25)4-7-23-12-14(19)10-20-23;2-1-3/h10,12-13H,4-9,11H2,1-3H3;1H,(H,2,3) |
| InChIKey | KNUUTJFJSCODCS-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 116.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.92 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|