C18H19N3O3S — CID 96574272
(5S)-7-[2-(1-methylindol-3-yl)sulfanylacetyl]-2,7-diazaspiro[4.4]nonane-1,3-dione (PubChem CID 96574272) has the molecular formula C18H19N3O3S and a molecular weight of 357.44 g/mol. Its IUPAC name is (5S)-7-[2-(1-methylindol-3-yl)sulfanylacetyl]-2,7-diazaspiro[4.4]nonane-1,3-dione.
| Compound Name | (5S)-7-[2-(1-methylindol-3-yl)sulfanylacetyl]-2,7-diazaspiro[4.4]nonane-1,3-dione |
|---|---|
| PubChem CID | 96574272 |
| Molecular Formula | C18H19N3O3S |
| Molecular Weight | 357.44 g/mol |
| Exact Mass | 357.11 |
| IUPAC Name | (5S)-7-[2-(1-methylindol-3-yl)sulfanylacetyl]-2,7-diazaspiro[4.4]nonane-1,3-dione |
| SMILES | Cn1cc(SCC(=O)N2CC[C@]3(CC(=O)NC3=O)C2)c2ccccc21 |
| InChI | InChI=1S/C18H19N3O3S/c1-20-9-14(12-4-2-3-5-13(12)20)25-10-16(23)21-7-6-18(11-21)8-15(22)19-17(18)24/h2-5,9H,6-8,10-11H2,1H3,(H,19,22,24)/t18-/m0/s1 |
| InChIKey | QXLOCINBEWHLON-SFHVURJKSA-N |
| XLogP | 1.54 |
| TPSA | 71.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.44 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|