About 1-[(3S,4S)-3-ethoxy-4-hydroxypyrrolidin-1-yl]-2-(1-methylindol-3-yl)sulfanylethanone
1-[(3S,4S)-3-ethoxy-4-hydroxypyrrolidin-1-yl]-2-(1-methylindol-3-yl)sulfanylethanone (PubChem CID 91791718) has the molecular formula C17H22N2O3S
and a molecular weight of 334.44 g/mol. Its IUPAC name is 1-[(3S,4S)-3-ethoxy-4-hydroxypyrrolidin-1-yl]-2-(1-methylindol-3-yl)sulfanylethanone.
Molecular Properties
| Compound Name | 1-[(3S,4S)-3-ethoxy-4-hydroxypyrrolidin-1-yl]-2-(1-methylindol-3-yl)sulfanylethanone |
| PubChem CID | 91791718 |
| Molecular Formula | C17H22N2O3S |
| Molecular Weight | 334.44 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | 1-[(3S,4S)-3-ethoxy-4-hydroxypyrrolidin-1-yl]-2-(1-methylindol-3-yl)sulfanylethanone |
| SMILES | CCO[C@H]1CN(C(=O)CSc2cn(C)c3ccccc23)C[C@@H]1O |
| InChI | InChI=1S/C17H22N2O3S/c1-3-22-15-9-19(8-14(15)20)17(21)11-23-16-10-18(2)13-7-5-4-6-12(13)16/h4-7,10,14-15,20H,3,8-9,11H2,1-2H3/t14-,15-/m0/s1 |
| InChIKey | SEQPTYWZGWNEIA-GJZGRUSLSA-N |
| XLogP | 1.88 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.44 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[(3S,4S)-3-ethoxy-4-hydroxypyrrolidin-1-yl]-2-(1-methylindol-3-yl)sulfanylethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(3S,4S)-3-ethoxy-4-hydroxypyrrolidin-1-yl]-2-(1-methylindol-3-yl)sulfanylethanone?
The IUPAC name of 1-[(3S,4S)-3-ethoxy-4-hydroxypyrrolidin-1-yl]-2-(1-methylindol-3-yl)sulfanylethanone (CID 91791718) is 1-[(3S,4S)-3-ethoxy-4-hydroxypyrrolidin-1-yl]-2-(1-methylindol-3-yl)sulfanylethanone.
What is the SMILES notation for 1-[(3S,4S)-3-ethoxy-4-hydroxypyrrolidin-1-yl]-2-(1-methylindol-3-yl)sulfanylethanone?
The canonical SMILES for 1-[(3S,4S)-3-ethoxy-4-hydroxypyrrolidin-1-yl]-2-(1-methylindol-3-yl)sulfanylethanone is CCO[C@H]1CN(C(=O)CSc2cn(C)c3ccccc23)C[C@@H]1O.
What is the InChIKey of 1-[(3S,4S)-3-ethoxy-4-hydroxypyrrolidin-1-yl]-2-(1-methylindol-3-yl)sulfanylethanone?
The InChIKey is SEQPTYWZGWNEIA-GJZGRUSLSA-N. The full InChI is InChI=1S/C17H22N2O3S/c1-3-22-15-9-19(8-14(15)20)17(21)11-23-16-10-18(2)13-7-5-4-6-12(13)16/h4-7,10,14-15,20H,3,8-9,11H2,1-2H3/t14-,15-/m0/s1.
What are the key properties of 1-[(3S,4S)-3-ethoxy-4-hydroxypyrrolidin-1-yl]-2-(1-methylindol-3-yl)sulfanylethanone?
1-[(3S,4S)-3-ethoxy-4-hydroxypyrrolidin-1-yl]-2-(1-methylindol-3-yl)sulfanylethanone has a molecular weight of 334.44 g/mol, XLogP of 1.88, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(3S,4S)-3-ethoxy-4-hydroxypyrrolidin-1-yl]-2-(1-methylindol-3-yl)sulfanylethanone is sourced from PubChem (CID 91791718), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).