C16H26N4OS — CID 70774438
N-(3-cyclohexylsulfanylpropyl)-4,5,6,7-tetrahydro-1H-imidazo[4,5-c]pyridine-4-carboxamide (PubChem CID 70774438) has the molecular formula C16H26N4OS and a molecular weight of 322.48 g/mol. Its IUPAC name is N-(3-cyclohexylsulfanylpropyl)-4,5,6,7-tetrahydro-1H-imidazo[4,5-c]pyridine-4-carboxamide.
| Compound Name | N-(3-cyclohexylsulfanylpropyl)-4,5,6,7-tetrahydro-1H-imidazo[4,5-c]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 70774438 |
| Molecular Formula | C16H26N4OS |
| Molecular Weight | 322.48 g/mol |
| Exact Mass | 322.18 |
| IUPAC Name | N-(3-cyclohexylsulfanylpropyl)-4,5,6,7-tetrahydro-1H-imidazo[4,5-c]pyridine-4-carboxamide |
| SMILES | O=C(NCCCSC1CCCCC1)C1NCCc2[nH]cnc21 |
| InChI | InChI=1S/C16H26N4OS/c21-16(15-14-13(7-9-17-15)19-11-20-14)18-8-4-10-22-12-5-2-1-3-6-12/h11-12,15,17H,1-10H2,(H,18,21)(H,19,20) |
| InChIKey | PDHVDSKBPCEYEN-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.48 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|