About ethyl 2-[(3S,4R)-3-(methanesulfonamido)-4-propylpyrrolidin-1-yl]-1,3-oxazole-4-carboxylate
ethyl 2-[(3S,4R)-3-(methanesulfonamido)-4-propylpyrrolidin-1-yl]-1,3-oxazole-4-carboxylate (PubChem CID 70775705) has the molecular formula C14H23N3O5S
and a molecular weight of 345.42 g/mol. Its IUPAC name is ethyl 2-[(3S,4R)-3-(methanesulfonamido)-4-propylpyrrolidin-1-yl]-1,3-oxazole-4-carboxylate.
Molecular Properties
| Compound Name | ethyl 2-[(3S,4R)-3-(methanesulfonamido)-4-propylpyrrolidin-1-yl]-1,3-oxazole-4-carboxylate |
| PubChem CID | 70775705 |
| Molecular Formula | C14H23N3O5S |
| Molecular Weight | 345.42 g/mol |
| Exact Mass | 345.14 |
| IUPAC Name | ethyl 2-[(3S,4R)-3-(methanesulfonamido)-4-propylpyrrolidin-1-yl]-1,3-oxazole-4-carboxylate |
| SMILES | CCC[C@@H]1CN(c2nc(C(=O)OCC)co2)C[C@H]1NS(C)(=O)=O |
| InChI | InChI=1S/C14H23N3O5S/c1-4-6-10-7-17(8-11(10)16-23(3,19)20)14-15-12(9-22-14)13(18)21-5-2/h9-11,16H,4-8H2,1-3H3/t10-,11-/m1/s1 |
| InChIKey | HBVZMLZHSLSUCE-GHMZBOCLSA-N |
| XLogP | 1.01 |
| TPSA | 101.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.42 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze ethyl 2-[(3S,4R)-3-(methanesulfonamido)-4-propylpyrrolidin-1-yl]-1,3-oxazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[(3S,4R)-3-(methanesulfonamido)-4-propylpyrrolidin-1-yl]-1,3-oxazole-4-carboxylate?
The IUPAC name of ethyl 2-[(3S,4R)-3-(methanesulfonamido)-4-propylpyrrolidin-1-yl]-1,3-oxazole-4-carboxylate (CID 70775705) is ethyl 2-[(3S,4R)-3-(methanesulfonamido)-4-propylpyrrolidin-1-yl]-1,3-oxazole-4-carboxylate.
What is the SMILES notation for ethyl 2-[(3S,4R)-3-(methanesulfonamido)-4-propylpyrrolidin-1-yl]-1,3-oxazole-4-carboxylate?
The canonical SMILES for ethyl 2-[(3S,4R)-3-(methanesulfonamido)-4-propylpyrrolidin-1-yl]-1,3-oxazole-4-carboxylate is CCC[C@@H]1CN(c2nc(C(=O)OCC)co2)C[C@H]1NS(C)(=O)=O.
What is the InChIKey of ethyl 2-[(3S,4R)-3-(methanesulfonamido)-4-propylpyrrolidin-1-yl]-1,3-oxazole-4-carboxylate?
The InChIKey is HBVZMLZHSLSUCE-GHMZBOCLSA-N. The full InChI is InChI=1S/C14H23N3O5S/c1-4-6-10-7-17(8-11(10)16-23(3,19)20)14-15-12(9-22-14)13(18)21-5-2/h9-11,16H,4-8H2,1-3H3/t10-,11-/m1/s1.
What are the key properties of ethyl 2-[(3S,4R)-3-(methanesulfonamido)-4-propylpyrrolidin-1-yl]-1,3-oxazole-4-carboxylate?
ethyl 2-[(3S,4R)-3-(methanesulfonamido)-4-propylpyrrolidin-1-yl]-1,3-oxazole-4-carboxylate has a molecular weight of 345.42 g/mol, XLogP of 1.01, 7 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[(3S,4R)-3-(methanesulfonamido)-4-propylpyrrolidin-1-yl]-1,3-oxazole-4-carboxylate is sourced from PubChem (CID 70775705), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).