C15H18N6O2S — CID 70778357
5-methoxy-1-methyl-N-[2-(1-methyltetrazol-5-yl)sulfanylethyl]indole-2-carboxamide (PubChem CID 70778357) has the molecular formula C15H18N6O2S and a molecular weight of 346.42 g/mol. Its IUPAC name is 5-methoxy-1-methyl-N-[2-(1-methyltetrazol-5-yl)sulfanylethyl]indole-2-carboxamide.
| Compound Name | 5-methoxy-1-methyl-N-[2-(1-methyltetrazol-5-yl)sulfanylethyl]indole-2-carboxamide |
|---|---|
| PubChem CID | 70778357 |
| Molecular Formula | C15H18N6O2S |
| Molecular Weight | 346.42 g/mol |
| Exact Mass | 346.12 |
| IUPAC Name | 5-methoxy-1-methyl-N-[2-(1-methyltetrazol-5-yl)sulfanylethyl]indole-2-carboxamide |
| SMILES | COc1ccc2c(c1)cc(C(=O)NCCSc1nnnn1C)n2C |
| InChI | InChI=1S/C15H18N6O2S/c1-20-12-5-4-11(23-3)8-10(12)9-13(20)14(22)16-6-7-24-15-17-18-19-21(15)2/h4-5,8-9H,6-7H2,1-3H3,(H,16,22) |
| InChIKey | KRSMNAYFTNIYIF-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 86.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.42 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|