C17H18N4O5 — CID 72885216
4-[3-[(5-methoxy-1-methylindole-2-carbonyl)amino]propyl]-1,2,5-oxadiazole-3-carboxylic acid (PubChem CID 72885216) has the molecular formula C17H18N4O5 and a molecular weight of 358.35 g/mol. Its IUPAC name is 4-[3-[(5-methoxy-1-methylindole-2-carbonyl)amino]propyl]-1,2,5-oxadiazole-3-carboxylic acid.
| Compound Name | 4-[3-[(5-methoxy-1-methylindole-2-carbonyl)amino]propyl]-1,2,5-oxadiazole-3-carboxylic acid |
|---|---|
| PubChem CID | 72885216 |
| Molecular Formula | C17H18N4O5 |
| Molecular Weight | 358.35 g/mol |
| Exact Mass | 358.13 |
| IUPAC Name | 4-[3-[(5-methoxy-1-methylindole-2-carbonyl)amino]propyl]-1,2,5-oxadiazole-3-carboxylic acid |
| SMILES | COc1ccc2c(c1)cc(C(=O)NCCCc1nonc1C(=O)O)n2C |
| InChI | InChI=1S/C17H18N4O5/c1-21-13-6-5-11(25-2)8-10(13)9-14(21)16(22)18-7-3-4-12-15(17(23)24)20-26-19-12/h5-6,8-9H,3-4,7H2,1-2H3,(H,18,22)(H,23,24) |
| InChIKey | AVLOBERLCCTSRG-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 119.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.35 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|