C17H20N4O3S — CID 70785168
4-(cyclobutylsulfamoyl)-N-(2-pyrazin-2-ylethyl)benzamide (PubChem CID 70785168) has the molecular formula C17H20N4O3S and a molecular weight of 360.44 g/mol. Its IUPAC name is 4-(cyclobutylsulfamoyl)-N-(2-pyrazin-2-ylethyl)benzamide.
| Compound Name | 4-(cyclobutylsulfamoyl)-N-(2-pyrazin-2-ylethyl)benzamide |
|---|---|
| PubChem CID | 70785168 |
| Molecular Formula | C17H20N4O3S |
| Molecular Weight | 360.44 g/mol |
| Exact Mass | 360.13 |
| IUPAC Name | 4-(cyclobutylsulfamoyl)-N-(2-pyrazin-2-ylethyl)benzamide |
| SMILES | O=C(NCCc1cnccn1)c1ccc(S(=O)(=O)NC2CCC2)cc1 |
| InChI | InChI=1S/C17H20N4O3S/c22-17(20-9-8-15-12-18-10-11-19-15)13-4-6-16(7-5-13)25(23,24)21-14-2-1-3-14/h4-7,10-12,14,21H,1-3,8-9H2,(H,20,22) |
| InChIKey | ULUOUTJMYQVOMW-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 101.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.44 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |