C33H37N5O4 — CID 70797039
7-benzyl-1-(4-pyrrolidin-1-ylbutyl)-2-(3,4,5-trimethoxyphenyl)-5H-imidazo[4,5-g]quinoxalin-6-one (PubChem CID 70797039) has the molecular formula C33H37N5O4 and a molecular weight of 567.69 g/mol. Its IUPAC name is 7-benzyl-1-(4-pyrrolidin-1-ylbutyl)-2-(3,4,5-trimethoxyphenyl)-5H-imidazo[4,5-g]quinoxalin-6-one.
| Compound Name | 7-benzyl-1-(4-pyrrolidin-1-ylbutyl)-2-(3,4,5-trimethoxyphenyl)-5H-imidazo[4,5-g]quinoxalin-6-one |
|---|---|
| PubChem CID | 70797039 |
| Molecular Formula | C33H37N5O4 |
| Molecular Weight | 567.69 g/mol |
| Exact Mass | 567.28 |
| IUPAC Name | 7-benzyl-1-(4-pyrrolidin-1-ylbutyl)-2-(3,4,5-trimethoxyphenyl)-5H-imidazo[4,5-g]quinoxalin-6-one |
| SMILES | COc1cc(-c2nc3cc4[nH]c(=O)c(Cc5ccccc5)nc4cc3n2CCCCN2CCCC2)cc(OC)c1OC |
| InChI | InChI=1S/C33H37N5O4/c1-40-29-18-23(19-30(41-2)31(29)42-3)32-35-26-20-24-25(34-27(33(39)36-24)17-22-11-5-4-6-12-22)21-28(26)38(32)16-10-9-15-37-13-7-8-14-37/h4-6,11-12,18-21H,7-10,13-17H2,1-3H3,(H,36,39) |
| InChIKey | MCSACYZWGZWVJC-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 94.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.69 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|