C29H19NO2 — CID 70798463
15,15-dimethyl-5-azaheptacyclo[14.12.0.02,14.04,12.06,11.018,27.020,25]octacosa-1(28),2(14),3,6,8,10,12,16,18(27),20,22,24-dodecaene-19,26-dione (PubChem CID 70798463) has the molecular formula C29H19NO2 and a molecular weight of 413.48 g/mol. Its IUPAC name is 15,15-dimethyl-5-azaheptacyclo[14.12.0.02,14.04,12.06,11.018,27.020,25]octacosa-1(28),2(14),3,6,8,10,12,16,18(27),20,22,24-dodecaene-19,26-dione.
| Compound Name | 15,15-dimethyl-5-azaheptacyclo[14.12.0.02,14.04,12.06,11.018,27.020,25]octacosa-1(28),2(14),3,6,8,10,12,16,18(27),20,22,24-dodecaene-19,26-dione |
|---|---|
| PubChem CID | 70798463 |
| Molecular Formula | C29H19NO2 |
| Molecular Weight | 413.48 g/mol |
| Exact Mass | 413.14 |
| IUPAC Name | 15,15-dimethyl-5-azaheptacyclo[14.12.0.02,14.04,12.06,11.018,27.020,25]octacosa-1(28),2(14),3,6,8,10,12,16,18(27),20,22,24-dodecaene-19,26-dione |
| SMILES | CC1(C)c2cc3c(cc2-c2cc4[nH]c5ccccc5c4cc21)C(=O)c1ccccc1C3=O |
| InChI | InChI=1S/C29H19NO2/c1-29(2)23-12-20-15-7-5-6-10-25(15)30-26(20)14-19(23)18-11-21-22(13-24(18)29)28(32)17-9-4-3-8-16(17)27(21)31/h3-14,30H,1-2H3 |
| InChIKey | KZFKYMFKHVFZQT-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 49.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.48 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|