C34H68N14O8S2 — CID 70799014
2-[2-[2-[[4,6-bis[2-(diethylamino)ethoxy]-1,3,5-triazin-2-yl]amino]ethylsulfamoylsulfonylamino]ethylamino]-4,6-bis[2-(diethylamino)ethoxy]-1,3,5-triazine (PubChem CID 70799014) has the molecular formula C34H68N14O8S2 and a molecular weight of 865.14 g/mol. Its IUPAC name is 2-[2-[2-[[4,6-bis[2-(diethylamino)ethoxy]-1,3,5-triazin-2-yl]amino]ethylsulfamoylsulfonylamino]ethylamino]-4,6-bis[2-(diethylamino)ethoxy]-1,3,5-triazine.
| Compound Name | 2-[2-[2-[[4,6-bis[2-(diethylamino)ethoxy]-1,3,5-triazin-2-yl]amino]ethylsulfamoylsulfonylamino]ethylamino]-4,6-bis[2-(diethylamino)ethoxy]-1,3,5-triazine |
|---|---|
| PubChem CID | 70799014 |
| Molecular Formula | C34H68N14O8S2 |
| Molecular Weight | 865.14 g/mol |
| Exact Mass | 864.48 |
| IUPAC Name | 2-[2-[2-[[4,6-bis[2-(diethylamino)ethoxy]-1,3,5-triazin-2-yl]amino]ethylsulfamoylsulfonylamino]ethylamino]-4,6-bis[2-(diethylamino)ethoxy]-1,3,5-triazine |
| SMILES | CCN(CC)CCOc1nc(NCCNS(=O)(=O)S(=O)(=O)NCCNc2nc(OCCN(CC)CC)nc(OCCN(CC)CC)n2)nc(OCCN(CC)CC)n1 |
| InChI | InChI=1S/C34H68N14O8S2/c1-9-45(10-2)21-25-53-31-39-29(40-32(43-31)54-26-22-46(11-3)12-4)35-17-19-37-57(49,50)58(51,52)38-20-18-36-30-41-33(55-27-23-47(13-5)14-6)44-34(42-30)56-28-24-48(15-7)16-8/h37-38H,9-28H2,1-8H3,(H,35,39,40,43)(H,36,41,42,44) |
| InChIKey | BZGFXPLLOAFVTF-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 243.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 20 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 865.14 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 20 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|