C27H39N5OS — CID 70799661
N-[1-[4-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-1,3-thiazol-2-yl]piperidin-4-yl]piperazine-2-carboxamide (PubChem CID 70799661) has the molecular formula C27H39N5OS and a molecular weight of 481.71 g/mol. Its IUPAC name is N-[1-[4-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-1,3-thiazol-2-yl]piperidin-4-yl]piperazine-2-carboxamide.
| Compound Name | N-[1-[4-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-1,3-thiazol-2-yl]piperidin-4-yl]piperazine-2-carboxamide |
|---|---|
| PubChem CID | 70799661 |
| Molecular Formula | C27H39N5OS |
| Molecular Weight | 481.71 g/mol |
| Exact Mass | 481.29 |
| IUPAC Name | N-[1-[4-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-1,3-thiazol-2-yl]piperidin-4-yl]piperazine-2-carboxamide |
| SMILES | CC1(C)CCC(C)(C)c2cc(-c3csc(N4CCC(NC(=O)C5CNCCN5)CC4)n3)ccc21 |
| InChI | InChI=1S/C27H39N5OS/c1-26(2)9-10-27(3,4)21-15-18(5-6-20(21)26)23-17-34-25(31-23)32-13-7-19(8-14-32)30-24(33)22-16-28-11-12-29-22/h5-6,15,17,19,22,28-29H,7-14,16H2,1-4H3,(H,30,33) |
| InChIKey | YXIVWJYSBRGOGY-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 69.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.71 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |