C26H39N3O2S — CID 157293663
(2S,3R)-2-amino-4-[1-[4-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-1,3-thiazol-2-yl]piperidin-4-yl]butane-1,3-diol (PubChem CID 157293663) has the molecular formula C26H39N3O2S and a molecular weight of 457.68 g/mol. Its IUPAC name is (2S,3R)-2-amino-4-[1-[4-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-1,3-thiazol-2-yl]piperidin-4-yl]butane-1,3-diol.
| Compound Name | (2S,3R)-2-amino-4-[1-[4-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-1,3-thiazol-2-yl]piperidin-4-yl]butane-1,3-diol |
|---|---|
| PubChem CID | 157293663 |
| Molecular Formula | C26H39N3O2S |
| Molecular Weight | 457.68 g/mol |
| Exact Mass | 457.28 |
| IUPAC Name | (2S,3R)-2-amino-4-[1-[4-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-1,3-thiazol-2-yl]piperidin-4-yl]butane-1,3-diol |
| SMILES | CC1(C)CCC(C)(C)c2cc(-c3csc(N4CCC(C[C@@H](O)[C@@H](N)CO)CC4)n3)ccc21 |
| InChI | InChI=1S/C26H39N3O2S/c1-25(2)9-10-26(3,4)20-14-18(5-6-19(20)25)22-16-32-24(28-22)29-11-7-17(8-12-29)13-23(31)21(27)15-30/h5-6,14,16-17,21,23,30-31H,7-13,15,27H2,1-4H3/t21-,23+/m0/s1 |
| InChIKey | WTOUNSUVZVJFHN-JTHBVZDNSA-N |
| XLogP | 4.45 |
| TPSA | 82.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.68 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |