C26H40N4OS — CID 70799667
(3R)-3-amino-4-[[1-[4-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-1,3-thiazol-2-yl]piperidin-4-yl]amino]butan-1-ol (PubChem CID 70799667) has the molecular formula C26H40N4OS and a molecular weight of 456.70 g/mol. Its IUPAC name is (3R)-3-amino-4-[[1-[4-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-1,3-thiazol-2-yl]piperidin-4-yl]amino]butan-1-ol.
| Compound Name | (3R)-3-amino-4-[[1-[4-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-1,3-thiazol-2-yl]piperidin-4-yl]amino]butan-1-ol |
|---|---|
| PubChem CID | 70799667 |
| Molecular Formula | C26H40N4OS |
| Molecular Weight | 456.70 g/mol |
| Exact Mass | 456.29 |
| IUPAC Name | (3R)-3-amino-4-[[1-[4-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-1,3-thiazol-2-yl]piperidin-4-yl]amino]butan-1-ol |
| SMILES | CC1(C)CCC(C)(C)c2cc(-c3csc(N4CCC(NC[C@H](N)CCO)CC4)n3)ccc21 |
| InChI | InChI=1S/C26H40N4OS/c1-25(2)10-11-26(3,4)22-15-18(5-6-21(22)25)23-17-32-24(29-23)30-12-7-20(8-13-30)28-16-19(27)9-14-31/h5-6,15,17,19-20,28,31H,7-14,16,27H2,1-4H3/t19-/m1/s1 |
| InChIKey | PEZFNFGHGMOKLP-LJQANCHMSA-N |
| XLogP | 4.43 |
| TPSA | 74.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.70 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |