C13H27NO2S — CID 70799705
N-tert-butyl-N-[(2-tert-butylcyclopropyl)methyl]methanesulfonamide (PubChem CID 70799705) has the molecular formula C13H27NO2S and a molecular weight of 261.43 g/mol. Its IUPAC name is N-tert-butyl-N-[(2-tert-butylcyclopropyl)methyl]methanesulfonamide.
| Compound Name | N-tert-butyl-N-[(2-tert-butylcyclopropyl)methyl]methanesulfonamide |
|---|---|
| PubChem CID | 70799705 |
| Molecular Formula | C13H27NO2S |
| Molecular Weight | 261.43 g/mol |
| Exact Mass | 261.18 |
| IUPAC Name | N-tert-butyl-N-[(2-tert-butylcyclopropyl)methyl]methanesulfonamide |
| SMILES | CC(C)(C)C1CC1CN(C(C)(C)C)S(C)(=O)=O |
| InChI | InChI=1S/C13H27NO2S/c1-12(2,3)11-8-10(11)9-14(13(4,5)6)17(7,15)16/h10-11H,8-9H2,1-7H3 |
| InChIKey | HVDUQDMNXGGNGK-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.43 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |