C28H37BrFN3O3 — CID 70801170
tert-butyl 4-[[(2R,4aS,5S,10bS)-9-bromo-5-cyclohexa-2,4-dien-1-yl-7-fluoro-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]piperazine-1-carboxylate (PubChem CID 70801170) has the molecular formula C28H37BrFN3O3 and a molecular weight of 562.52 g/mol. Its IUPAC name is tert-butyl 4-[[(2R,4aS,5S,10bS)-9-bromo-5-cyclohexa-2,4-dien-1-yl-7-fluoro-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[[(2R,4aS,5S,10bS)-9-bromo-5-cyclohexa-2,4-dien-1-yl-7-fluoro-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 70801170 |
| Molecular Formula | C28H37BrFN3O3 |
| Molecular Weight | 562.52 g/mol |
| Exact Mass | 561.20 |
| IUPAC Name | tert-butyl 4-[[(2R,4aS,5S,10bS)-9-bromo-5-cyclohexa-2,4-dien-1-yl-7-fluoro-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(C[C@H]2CC[C@@H]3[C@H](O2)c2cc(Br)cc(F)c2N[C@H]3C2C=CC=CC2)CC1 |
| InChI | InChI=1S/C28H37BrFN3O3/c1-28(2,3)36-27(34)33-13-11-32(12-14-33)17-20-9-10-21-24(18-7-5-4-6-8-18)31-25-22(26(21)35-20)15-19(29)16-23(25)30/h4-7,15-16,18,20-21,24,26,31H,8-14,17H2,1-3H3/t18?,20-,21+,24+,26+/m1/s1 |
| InChIKey | GTDGIWMBOPSVJK-AIRGGKBWSA-N |
| XLogP | 5.90 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.52 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |