C30H39F4N3O3 — CID 70804186
1-[4-(4-tert-butylphenyl)piperazin-1-yl]-2-[4-[3-(fluoromethyl)-4-(trifluoromethoxy)anilino]cyclohexyl]oxyethanone (PubChem CID 70804186) has the molecular formula C30H39F4N3O3 and a molecular weight of 565.65 g/mol. Its IUPAC name is 1-[4-(4-tert-butylphenyl)piperazin-1-yl]-2-[4-[3-(fluoromethyl)-4-(trifluoromethoxy)anilino]cyclohexyl]oxyethanone.
| Compound Name | 1-[4-(4-tert-butylphenyl)piperazin-1-yl]-2-[4-[3-(fluoromethyl)-4-(trifluoromethoxy)anilino]cyclohexyl]oxyethanone |
|---|---|
| PubChem CID | 70804186 |
| Molecular Formula | C30H39F4N3O3 |
| Molecular Weight | 565.65 g/mol |
| Exact Mass | 565.29 |
| IUPAC Name | 1-[4-(4-tert-butylphenyl)piperazin-1-yl]-2-[4-[3-(fluoromethyl)-4-(trifluoromethoxy)anilino]cyclohexyl]oxyethanone |
| SMILES | CC(C)(C)c1ccc(N2CCN(C(=O)COC3CCC(Nc4ccc(OC(F)(F)F)c(CF)c4)CC3)CC2)cc1 |
| InChI | InChI=1S/C30H39F4N3O3/c1-29(2,3)22-4-9-25(10-5-22)36-14-16-37(17-15-36)28(38)20-39-26-11-6-23(7-12-26)35-24-8-13-27(21(18-24)19-31)40-30(32,33)34/h4-5,8-10,13,18,23,26,35H,6-7,11-12,14-17,19-20H2,1-3H3 |
| InChIKey | BRWJUFYEBLEQNE-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.65 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|