C31H40F3N3O5 — CID 23648376
[(2S)-3-cyclohexyl-1-morpholin-4-yl-1-oxopropan-2-yl] N-[(2S)-4-phenyl-1-[4-(trifluoromethoxy)anilino]butan-2-yl]carbamate (PubChem CID 23648376) has the molecular formula C31H40F3N3O5 and a molecular weight of 591.67 g/mol. Its IUPAC name is [(2S)-3-cyclohexyl-1-morpholin-4-yl-1-oxopropan-2-yl] N-[(2S)-4-phenyl-1-[4-(trifluoromethoxy)anilino]butan-2-yl]carbamate.
| Compound Name | [(2S)-3-cyclohexyl-1-morpholin-4-yl-1-oxopropan-2-yl] N-[(2S)-4-phenyl-1-[4-(trifluoromethoxy)anilino]butan-2-yl]carbamate |
|---|---|
| PubChem CID | 23648376 |
| Molecular Formula | C31H40F3N3O5 |
| Molecular Weight | 591.67 g/mol |
| Exact Mass | 591.29 |
| IUPAC Name | [(2S)-3-cyclohexyl-1-morpholin-4-yl-1-oxopropan-2-yl] N-[(2S)-4-phenyl-1-[4-(trifluoromethoxy)anilino]butan-2-yl]carbamate |
| SMILES | O=C(N[C@@H](CCc1ccccc1)CNc1ccc(OC(F)(F)F)cc1)O[C@@H](CC1CCCCC1)C(=O)N1CCOCC1 |
| InChI | InChI=1S/C31H40F3N3O5/c32-31(33,34)42-27-15-13-25(14-16-27)35-22-26(12-11-23-7-3-1-4-8-23)36-30(39)41-28(21-24-9-5-2-6-10-24)29(38)37-17-19-40-20-18-37/h1,3-4,7-8,13-16,24,26,28,35H,2,5-6,9-12,17-22H2,(H,36,39)/t26-,28-/m0/s1 |
| InChIKey | WHBDOPKKFKNZRI-XCZPVHLTSA-N |
| XLogP | 5.92 |
| TPSA | 89.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.67 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|