C23H20FN3O3S — CID 70805072
(4aR)-9-(6-fluorocyclohexa-2,4-dien-1-yl)-3-(thiophene-2-carbonyl)-2,4,4a,6-tetrahydro-1H-pyrazino[2,1-c][1,4]benzodiazepine-5,11-dione (PubChem CID 70805072) has the molecular formula C23H20FN3O3S and a molecular weight of 437.50 g/mol. Its IUPAC name is (4aR)-9-(6-fluorocyclohexa-2,4-dien-1-yl)-3-(thiophene-2-carbonyl)-2,4,4a,6-tetrahydro-1H-pyrazino[2,1-c][1,4]benzodiazepine-5,11-dione.
| Compound Name | (4aR)-9-(6-fluorocyclohexa-2,4-dien-1-yl)-3-(thiophene-2-carbonyl)-2,4,4a,6-tetrahydro-1H-pyrazino[2,1-c][1,4]benzodiazepine-5,11-dione |
|---|---|
| PubChem CID | 70805072 |
| Molecular Formula | C23H20FN3O3S |
| Molecular Weight | 437.50 g/mol |
| Exact Mass | 437.12 |
| IUPAC Name | (4aR)-9-(6-fluorocyclohexa-2,4-dien-1-yl)-3-(thiophene-2-carbonyl)-2,4,4a,6-tetrahydro-1H-pyrazino[2,1-c][1,4]benzodiazepine-5,11-dione |
| SMILES | O=C1Nc2ccc(C3C=CC=CC3F)cc2C(=O)N2CCN(C(=O)c3cccs3)C[C@H]12 |
| InChI | InChI=1S/C23H20FN3O3S/c24-17-5-2-1-4-15(17)14-7-8-18-16(12-14)22(29)27-10-9-26(13-19(27)21(28)25-18)23(30)20-6-3-11-31-20/h1-8,11-12,15,17,19H,9-10,13H2,(H,25,28)/t15?,17?,19-/m1/s1 |
| InChIKey | ZQMTUDVEYRKAMM-GXOAENINSA-N |
| XLogP | 3.21 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.50 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |