C24H36O2 — CID 70805843
3-[1-(4-ethylphenyl)ethyl]-6-(4-propylcyclohexyl)oxan-2-one (PubChem CID 70805843) has the molecular formula C24H36O2 and a molecular weight of 356.55 g/mol. Its IUPAC name is 3-[1-(4-ethylphenyl)ethyl]-6-(4-propylcyclohexyl)oxan-2-one.
| Compound Name | 3-[1-(4-ethylphenyl)ethyl]-6-(4-propylcyclohexyl)oxan-2-one |
|---|---|
| PubChem CID | 70805843 |
| Molecular Formula | C24H36O2 |
| Molecular Weight | 356.55 g/mol |
| Exact Mass | 356.27 |
| IUPAC Name | 3-[1-(4-ethylphenyl)ethyl]-6-(4-propylcyclohexyl)oxan-2-one |
| SMILES | CCCC1CCC(C2CCC(C(C)c3ccc(CC)cc3)C(=O)O2)CC1 |
| InChI | InChI=1S/C24H36O2/c1-4-6-19-9-13-21(14-10-19)23-16-15-22(24(25)26-23)17(3)20-11-7-18(5-2)8-12-20/h7-8,11-12,17,19,21-23H,4-6,9-10,13-16H2,1-3H3 |
| InChIKey | VKHSNUXVNYYOHD-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.55 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |