C26H35N3O5 — CID 70807055
3-[3-[2-(3,4-dimethoxyphenyl)hydrazinyl]cyclohexyl]-7,8-dimethoxy-2,5-dihydro-1H-3-benzazepin-4-one (PubChem CID 70807055) has the molecular formula C26H35N3O5 and a molecular weight of 469.58 g/mol. Its IUPAC name is 3-[3-[2-(3,4-dimethoxyphenyl)hydrazinyl]cyclohexyl]-7,8-dimethoxy-2,5-dihydro-1H-3-benzazepin-4-one.
| Compound Name | 3-[3-[2-(3,4-dimethoxyphenyl)hydrazinyl]cyclohexyl]-7,8-dimethoxy-2,5-dihydro-1H-3-benzazepin-4-one |
|---|---|
| PubChem CID | 70807055 |
| Molecular Formula | C26H35N3O5 |
| Molecular Weight | 469.58 g/mol |
| Exact Mass | 469.26 |
| IUPAC Name | 3-[3-[2-(3,4-dimethoxyphenyl)hydrazinyl]cyclohexyl]-7,8-dimethoxy-2,5-dihydro-1H-3-benzazepin-4-one |
| SMILES | COc1ccc(NNC2CCCC(N3CCc4cc(OC)c(OC)cc4CC3=O)C2)cc1OC |
| InChI | InChI=1S/C26H35N3O5/c1-31-22-9-8-20(16-25(22)34-4)28-27-19-6-5-7-21(15-19)29-11-10-17-12-23(32-2)24(33-3)13-18(17)14-26(29)30/h8-9,12-13,16,19,21,27-28H,5-7,10-11,14-15H2,1-4H3 |
| InChIKey | CRSQISRIKGFNLQ-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 81.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.58 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|