C21H27ClO6 — CID 70810686
(2S,3R,4R,5S,6R)-2-[4-chloro-3-[(4-ethoxyphenyl)methyl]cyclohexa-2,4-dien-1-yl]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 70810686) has the molecular formula C21H27ClO6 and a molecular weight of 410.89 g/mol. Its IUPAC name is (2S,3R,4R,5S,6R)-2-[4-chloro-3-[(4-ethoxyphenyl)methyl]cyclohexa-2,4-dien-1-yl]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2S,3R,4R,5S,6R)-2-[4-chloro-3-[(4-ethoxyphenyl)methyl]cyclohexa-2,4-dien-1-yl]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 70810686 |
| Molecular Formula | C21H27ClO6 |
| Molecular Weight | 410.89 g/mol |
| Exact Mass | 410.15 |
| IUPAC Name | (2S,3R,4R,5S,6R)-2-[4-chloro-3-[(4-ethoxyphenyl)methyl]cyclohexa-2,4-dien-1-yl]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | CCOc1ccc(CC2=CC([C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)CC=C2Cl)cc1 |
| InChI | InChI=1S/C21H27ClO6/c1-2-27-15-6-3-12(4-7-15)9-14-10-13(5-8-16(14)22)21-20(26)19(25)18(24)17(11-23)28-21/h3-4,6-8,10,13,17-21,23-26H,2,5,9,11H2,1H3/t13?,17-,18-,19+,20-,21+/m1/s1 |
| InChIKey | VYBIXGXMXJZJMQ-KHFDBEMRSA-N |
| XLogP | 1.54 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.89 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |