C17H20FNO3 — CID 70812013
[(E)-but-2-en-2-yl] (2R)-2-(4-fluoro-2-methylphenyl)-4-oxopiperidine-1-carboxylate (PubChem CID 70812013) has the molecular formula C17H20FNO3 and a molecular weight of 305.35 g/mol. Its IUPAC name is [(E)-but-2-en-2-yl] (2R)-2-(4-fluoro-2-methylphenyl)-4-oxopiperidine-1-carboxylate.
| Compound Name | [(E)-but-2-en-2-yl] (2R)-2-(4-fluoro-2-methylphenyl)-4-oxopiperidine-1-carboxylate |
|---|---|
| PubChem CID | 70812013 |
| Molecular Formula | C17H20FNO3 |
| Molecular Weight | 305.35 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | [(E)-but-2-en-2-yl] (2R)-2-(4-fluoro-2-methylphenyl)-4-oxopiperidine-1-carboxylate |
| SMILES | C/C=C(\C)OC(=O)N1CCC(=O)C[C@@H]1c1ccc(F)cc1C |
| InChI | InChI=1S/C17H20FNO3/c1-4-12(3)22-17(21)19-8-7-14(20)10-16(19)15-6-5-13(18)9-11(15)2/h4-6,9,16H,7-8,10H2,1-3H3/b12-4+/t16-/m1/s1 |
| InChIKey | QECMIHQAOGFNHV-OOQVMBGTSA-N |
| XLogP | 3.90 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.35 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|