C13H23N3O6 — CID 70812112
2-[[(4R)-4-amino-5-(2-morpholin-4-ylethoxy)-5-oxopentanoyl]amino]acetic acid (PubChem CID 70812112) has the molecular formula C13H23N3O6 and a molecular weight of 317.34 g/mol. Its IUPAC name is 2-[[(4R)-4-amino-5-(2-morpholin-4-ylethoxy)-5-oxopentanoyl]amino]acetic acid.
| Compound Name | 2-[[(4R)-4-amino-5-(2-morpholin-4-ylethoxy)-5-oxopentanoyl]amino]acetic acid |
|---|---|
| PubChem CID | 70812112 |
| Molecular Formula | C13H23N3O6 |
| Molecular Weight | 317.34 g/mol |
| Exact Mass | 317.16 |
| IUPAC Name | 2-[[(4R)-4-amino-5-(2-morpholin-4-ylethoxy)-5-oxopentanoyl]amino]acetic acid |
| SMILES | N[C@H](CCC(=O)NCC(=O)O)C(=O)OCCN1CCOCC1 |
| InChI | InChI=1S/C13H23N3O6/c14-10(1-2-11(17)15-9-12(18)19)13(20)22-8-5-16-3-6-21-7-4-16/h10H,1-9,14H2,(H,15,17)(H,18,19)/t10-/m1/s1 |
| InChIKey | NEJURALNSUQXMI-SNVBAGLBSA-N |
| XLogP | -1.83 |
| TPSA | 131.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.34 |
| LogP ≤ 5 | -1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |