C13H23NO4 — CID 70815209
tert-butyl 3-hydroxy-3-(hydroxymethyl)-8-azabicyclo[3.2.1]octane-1-carboxylate (PubChem CID 70815209) has the molecular formula C13H23NO4 and a molecular weight of 257.33 g/mol. Its IUPAC name is tert-butyl 3-hydroxy-3-(hydroxymethyl)-8-azabicyclo[3.2.1]octane-1-carboxylate.
| Compound Name | tert-butyl 3-hydroxy-3-(hydroxymethyl)-8-azabicyclo[3.2.1]octane-1-carboxylate |
|---|---|
| PubChem CID | 70815209 |
| Molecular Formula | C13H23NO4 |
| Molecular Weight | 257.33 g/mol |
| Exact Mass | 257.16 |
| IUPAC Name | tert-butyl 3-hydroxy-3-(hydroxymethyl)-8-azabicyclo[3.2.1]octane-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)C12CCC(CC(O)(CO)C1)N2 |
| InChI | InChI=1S/C13H23NO4/c1-11(2,3)18-10(16)13-5-4-9(14-13)6-12(17,7-13)8-15/h9,14-15,17H,4-8H2,1-3H3 |
| InChIKey | RRAOJPOFMNWPIL-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.33 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |