C15H19N4OS+ — CID 7081629
(5E)-5-[[4-(4-methylpiperazin-4-ium-1-yl)phenyl]methylidene]-2-sulfanylideneimidazolidin-4-one (PubChem CID 7081629) has the molecular formula C15H19N4OS+ and a molecular weight of 303.41 g/mol. Its IUPAC name is (5E)-5-[[4-(4-methylpiperazin-4-ium-1-yl)phenyl]methylidene]-2-sulfanylideneimidazolidin-4-one.
| Compound Name | (5E)-5-[[4-(4-methylpiperazin-4-ium-1-yl)phenyl]methylidene]-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 7081629 |
| Molecular Formula | C15H19N4OS+ |
| Molecular Weight | 303.41 g/mol |
| Exact Mass | 303.13 |
| IUPAC Name | (5E)-5-[[4-(4-methylpiperazin-4-ium-1-yl)phenyl]methylidene]-2-sulfanylideneimidazolidin-4-one |
| SMILES | C[NH+]1CCN(c2ccc(/C=C3/NC(=S)NC3=O)cc2)CC1 |
| InChI | InChI=1S/C15H18N4OS/c1-18-6-8-19(9-7-18)12-4-2-11(3-5-12)10-13-14(20)17-15(21)16-13/h2-5,10H,6-9H2,1H3,(H2,16,17,20,21)/p+1/b13-10+ |
| InChIKey | ORMOWGZHDHMYSF-JLHYYAGUSA-O |
| XLogP | -0.63 |
| TPSA | 48.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.41 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|