C12H21NO — CID 7082197
(1S,2R,5S,8S)-2-pyrrolidin-1-ylbicyclo[3.2.1]octan-8-ol (PubChem CID 7082197) has the molecular formula C12H21NO and a molecular weight of 195.31 g/mol. Its IUPAC name is (1S,2R,5S,8S)-2-pyrrolidin-1-ylbicyclo[3.2.1]octan-8-ol.
| Compound Name | (1S,2R,5S,8S)-2-pyrrolidin-1-ylbicyclo[3.2.1]octan-8-ol |
|---|---|
| PubChem CID | 7082197 |
| Molecular Formula | C12H21NO |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.16 |
| IUPAC Name | (1S,2R,5S,8S)-2-pyrrolidin-1-ylbicyclo[3.2.1]octan-8-ol |
| SMILES | O[C@H]1[C@H]2CC[C@H]1[C@H](N1CCCC1)CC2 |
| InChI | InChI=1S/C12H21NO/c14-12-9-3-5-10(12)11(6-4-9)13-7-1-2-8-13/h9-12,14H,1-8H2/t9-,10-,11+,12-/m0/s1 |
| InChIKey | LKOQOTHHSPGEKE-YFKTTZPYSA-N |
| XLogP | 1.63 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |