C19H18N2O — CID 70824003
2-cyano-N-(4-phenyl-1,2,3,4-tetrahydronaphthalen-2-yl)acetamide (PubChem CID 70824003) has the molecular formula C19H18N2O and a molecular weight of 290.37 g/mol. Its IUPAC name is 2-cyano-N-(4-phenyl-1,2,3,4-tetrahydronaphthalen-2-yl)acetamide.
| Compound Name | 2-cyano-N-(4-phenyl-1,2,3,4-tetrahydronaphthalen-2-yl)acetamide |
|---|---|
| PubChem CID | 70824003 |
| Molecular Formula | C19H18N2O |
| Molecular Weight | 290.37 g/mol |
| Exact Mass | 290.14 |
| IUPAC Name | 2-cyano-N-(4-phenyl-1,2,3,4-tetrahydronaphthalen-2-yl)acetamide |
| SMILES | N#CCC(=O)NC1Cc2ccccc2C(c2ccccc2)C1 |
| InChI | InChI=1S/C19H18N2O/c20-11-10-19(22)21-16-12-15-8-4-5-9-17(15)18(13-16)14-6-2-1-3-7-14/h1-9,16,18H,10,12-13H2,(H,21,22) |
| InChIKey | KJXCVYHKEZPYIX-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.37 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |