C25H27N — CID 10382704
(2S,4R)-4-phenyl-N-(3-phenylpropyl)-1,2,3,4-tetrahydronaphthalen-2-amine (PubChem CID 10382704) has the molecular formula C25H27N and a molecular weight of 341.50 g/mol. Its IUPAC name is (2S,4R)-4-phenyl-N-(3-phenylpropyl)-1,2,3,4-tetrahydronaphthalen-2-amine.
| Compound Name | (2S,4R)-4-phenyl-N-(3-phenylpropyl)-1,2,3,4-tetrahydronaphthalen-2-amine |
|---|---|
| PubChem CID | 10382704 |
| Molecular Formula | C25H27N |
| Molecular Weight | 341.50 g/mol |
| Exact Mass | 341.21 |
| IUPAC Name | (2S,4R)-4-phenyl-N-(3-phenylpropyl)-1,2,3,4-tetrahydronaphthalen-2-amine |
| SMILES | c1ccc(CCCN[C@@H]2Cc3ccccc3[C@@H](c3ccccc3)C2)cc1 |
| InChI | InChI=1S/C25H27N/c1-3-10-20(11-4-1)12-9-17-26-23-18-22-15-7-8-16-24(22)25(19-23)21-13-5-2-6-14-21/h1-8,10-11,13-16,23,25-26H,9,12,17-19H2/t23-,25-/m1/s1 |
| InChIKey | DLHHIMFCIUQZER-ILBGXUMGSA-N |
| XLogP | 5.36 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.50 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|