C12H24O8 — CID 70825501
(3S,4R)-2-(hydroxymethyl)-6-[2-(1-hydroxy-2-methylpropoxy)ethoxy]oxane-3,4,5-triol (PubChem CID 70825501) has the molecular formula C12H24O8 and a molecular weight of 296.32 g/mol. Its IUPAC name is (3S,4R)-2-(hydroxymethyl)-6-[2-(1-hydroxy-2-methylpropoxy)ethoxy]oxane-3,4,5-triol.
| Compound Name | (3S,4R)-2-(hydroxymethyl)-6-[2-(1-hydroxy-2-methylpropoxy)ethoxy]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 70825501 |
| Molecular Formula | C12H24O8 |
| Molecular Weight | 296.32 g/mol |
| Exact Mass | 296.15 |
| IUPAC Name | (3S,4R)-2-(hydroxymethyl)-6-[2-(1-hydroxy-2-methylpropoxy)ethoxy]oxane-3,4,5-triol |
| SMILES | CC(C)C(O)OCCOC1OC(CO)[C@@H](O)[C@@H](O)C1O |
| InChI | InChI=1S/C12H24O8/c1-6(2)11(17)18-3-4-19-12-10(16)9(15)8(14)7(5-13)20-12/h6-17H,3-5H2,1-2H3/t7?,8-,9-,10?,11?,12?/m1/s1 |
| InChIKey | BTUIGSPEBPROOW-ZISJPFRHSA-N |
| XLogP | -2.21 |
| TPSA | 128.84 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.32 |
| LogP ≤ 5 | -2.21 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|