C18H15NS — CID 70828454
10-phenyl-2,3-dihydrophenothiazine (PubChem CID 70828454) has the molecular formula C18H15NS and a molecular weight of 277.39 g/mol. Its IUPAC name is 10-phenyl-2,3-dihydrophenothiazine.
| Compound Name | 10-phenyl-2,3-dihydrophenothiazine |
|---|---|
| PubChem CID | 70828454 |
| Molecular Formula | C18H15NS |
| Molecular Weight | 277.39 g/mol |
| Exact Mass | 277.09 |
| IUPAC Name | 10-phenyl-2,3-dihydrophenothiazine |
| SMILES | C1=C2Sc3ccccc3N(c3ccccc3)C2=CCC1 |
| InChI | InChI=1S/C18H15NS/c1-2-8-14(9-3-1)19-15-10-4-6-12-17(15)20-18-13-7-5-11-16(18)19/h1-4,6,8-13H,5,7H2 |
| InChIKey | PBSSUZHVTDLTMX-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.39 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |