C16H19ClN2 — CID 70830206
(2S,3S)-1-(5-chloro-2-pyridinyl)-2-phenylpentan-3-amine (PubChem CID 70830206) has the molecular formula C16H19ClN2 and a molecular weight of 274.80 g/mol. Its IUPAC name is (2S,3S)-1-(5-chloro-2-pyridinyl)-2-phenylpentan-3-amine.
| Compound Name | (2S,3S)-1-(5-chloro-2-pyridinyl)-2-phenylpentan-3-amine |
|---|---|
| PubChem CID | 70830206 |
| Molecular Formula | C16H19ClN2 |
| Molecular Weight | 274.80 g/mol |
| Exact Mass | 274.12 |
| IUPAC Name | (2S,3S)-1-(5-chloro-2-pyridinyl)-2-phenylpentan-3-amine |
| SMILES | CC[C@H](N)[C@@H](Cc1ccc(Cl)cn1)c1ccccc1 |
| InChI | InChI=1S/C16H19ClN2/c1-2-16(18)15(12-6-4-3-5-7-12)10-14-9-8-13(17)11-19-14/h3-9,11,15-16H,2,10,18H2,1H3/t15-,16-/m0/s1 |
| InChIKey | PFMWSNOJQFREGN-HOTGVXAUSA-N |
| XLogP | 3.80 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.80 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |