C26H26N4O — CID 70830445
5-[4-[(4-methylphenyl)methylamino]phenyl]-4-(phenylmethoxymethyl)pyrimidin-2-amine (PubChem CID 70830445) has the molecular formula C26H26N4O and a molecular weight of 410.52 g/mol. Its IUPAC name is 5-[4-[(4-methylphenyl)methylamino]phenyl]-4-(phenylmethoxymethyl)pyrimidin-2-amine.
| Compound Name | 5-[4-[(4-methylphenyl)methylamino]phenyl]-4-(phenylmethoxymethyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 70830445 |
| Molecular Formula | C26H26N4O |
| Molecular Weight | 410.52 g/mol |
| Exact Mass | 410.21 |
| IUPAC Name | 5-[4-[(4-methylphenyl)methylamino]phenyl]-4-(phenylmethoxymethyl)pyrimidin-2-amine |
| SMILES | Cc1ccc(CNc2ccc(-c3cnc(N)nc3COCc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C26H26N4O/c1-19-7-9-20(10-8-19)15-28-23-13-11-22(12-14-23)24-16-29-26(27)30-25(24)18-31-17-21-5-3-2-4-6-21/h2-14,16,28H,15,17-18H2,1H3,(H2,27,29,30) |
| InChIKey | IHPGYSHRMBNNJV-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.52 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |