C27H34N6O3 — CID 70830793
6-[(3-methoxyphenyl)methylcarbamoylamino]-1-methyl-N-[(6R)-1-methyl-2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridin-6-yl]indazole-3-carboxamide (PubChem CID 70830793) has the molecular formula C27H34N6O3 and a molecular weight of 490.61 g/mol. Its IUPAC name is 6-[(3-methoxyphenyl)methylcarbamoylamino]-1-methyl-N-[(6R)-1-methyl-2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridin-6-yl]indazole-3-carboxamide.
| Compound Name | 6-[(3-methoxyphenyl)methylcarbamoylamino]-1-methyl-N-[(6R)-1-methyl-2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridin-6-yl]indazole-3-carboxamide |
|---|---|
| PubChem CID | 70830793 |
| Molecular Formula | C27H34N6O3 |
| Molecular Weight | 490.61 g/mol |
| Exact Mass | 490.27 |
| IUPAC Name | 6-[(3-methoxyphenyl)methylcarbamoylamino]-1-methyl-N-[(6R)-1-methyl-2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridin-6-yl]indazole-3-carboxamide |
| SMILES | COc1cccc(CNC(=O)Nc2ccc3c(C(=O)N[C@@H]4CC5CCCN(C)C5C4)nn(C)c3c2)c1 |
| InChI | InChI=1S/C27H34N6O3/c1-32-11-5-7-18-13-20(15-23(18)32)29-26(34)25-22-10-9-19(14-24(22)33(2)31-25)30-27(35)28-16-17-6-4-8-21(12-17)36-3/h4,6,8-10,12,14,18,20,23H,5,7,11,13,15-16H2,1-3H3,(H,29,34)(H2,28,30,35)/t18?,20-,23?/m1/s1 |
| InChIKey | NVHMMVGUBRKNJL-WRSRUZKNSA-N |
| XLogP | 3.51 |
| TPSA | 100.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.61 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |