C12H14F2O4 — CID 70832174
methyl 5-butoxy-4,4-difluoro-3-oxocyclohexa-1,5-diene-1-carboxylate (PubChem CID 70832174) has the molecular formula C12H14F2O4 and a molecular weight of 260.24 g/mol. Its IUPAC name is methyl 5-butoxy-4,4-difluoro-3-oxocyclohexa-1,5-diene-1-carboxylate.
| Compound Name | methyl 5-butoxy-4,4-difluoro-3-oxocyclohexa-1,5-diene-1-carboxylate |
|---|---|
| PubChem CID | 70832174 |
| Molecular Formula | C12H14F2O4 |
| Molecular Weight | 260.24 g/mol |
| Exact Mass | 260.09 |
| IUPAC Name | methyl 5-butoxy-4,4-difluoro-3-oxocyclohexa-1,5-diene-1-carboxylate |
| SMILES | CCCCOC1=CC(C(=O)OC)=CC(=O)C1(F)F |
| InChI | InChI=1S/C12H14F2O4/c1-3-4-5-18-10-7-8(11(16)17-2)6-9(15)12(10,13)14/h6-7H,3-5H2,1-2H3 |
| InChIKey | KHKJSBLPUVKJFH-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.24 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|