C14H18N2O4S3 — CID 70835408
6-[(2-methylsulfanyl-1,3-benzothiazol-5-yl)sulfonylamino]hexanoic acid (PubChem CID 70835408) has the molecular formula C14H18N2O4S3 and a molecular weight of 374.51 g/mol. Its IUPAC name is 6-[(2-methylsulfanyl-1,3-benzothiazol-5-yl)sulfonylamino]hexanoic acid.
| Compound Name | 6-[(2-methylsulfanyl-1,3-benzothiazol-5-yl)sulfonylamino]hexanoic acid |
|---|---|
| PubChem CID | 70835408 |
| Molecular Formula | C14H18N2O4S3 |
| Molecular Weight | 374.51 g/mol |
| Exact Mass | 374.04 |
| IUPAC Name | 6-[(2-methylsulfanyl-1,3-benzothiazol-5-yl)sulfonylamino]hexanoic acid |
| SMILES | CSc1nc2cc(S(=O)(=O)NCCCCCC(=O)O)ccc2s1 |
| InChI | InChI=1S/C14H18N2O4S3/c1-21-14-16-11-9-10(6-7-12(11)22-14)23(19,20)15-8-4-2-3-5-13(17)18/h6-7,9,15H,2-5,8H2,1H3,(H,17,18) |
| InChIKey | KZNLDKVOBUQOJL-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 96.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.51 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|